CAS Registry Number 2486-69-3
Name:
Benzoic acid, 4-​amino-​3-​methoxy-
m-Anisic acid, 4-amino- (7CI,8CI)
3-Methoxy-4-aminobenzoic acid
4-Amino-3-methoxybenzoic acid
4-Amino-m-anisic acid
NSC 148472

Chemical Formula: C8H9NO3
Exact Mass: 167.06
Molecular Weight: 167.16
m/z: 167.06 (100.0%), 168.06 (9.2%)
Elemental Analysis: C, 57.48; H, 5.43; N, 8.38; O, 28.71

InChI:InChI=1S/C8H9NO3/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4H,9H2,1H3,(H,10,11)

Specification

98%

1. (3) Almeida, Ana R. R. P.; Journal of Physical Chemistry B 2010, V114(35), P11570-11575 CAPLUS
2. (4) Simonsen, John L.; Journal of the Chemical Society, Transactions 1917, V111, P220-36 CAPLUS
3. (5) Froelicher, Victor; Journal of the Chemical Society, Transactions 1921, V119, P1425-32 CAPLUS