CAS Registry Number 22439-48-1
Name:
2-​Dibenzofurancarboxyl​ic acid
NSC 90628

Chemical Formula: C13H8O3
Exact Mass: 212.05
Molecular Weight: 212.20
m/z: 212.05 (100.0%), 213.05 (14.3%), 214.05 (1.5%)

InChI:InChI=1S/C13H8O3/c14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7H,(H,14,15)

Specification

98%

1. (5) Ames, D. E.; Synthesis 1983, (3), P234-5 CAPLUS
2. (6) Glushkova, V. P.; Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya 1957, P1391-2 CAPLUS
3. (7) Aboul-Enein, Hassan Y.; European Journal of Medicinal Chemistry 1978, V13(2), P199-200 CAPLUS
4. (8) Chatterjea, J. N.; Journal of the Indian Chemical Society 1962, V39(9), P599-604 CAPLUS
5. (9) Johnson, Robert G.; Journal of the American Chemical Society 1954, V76, P6407-8 CAPLUS